C13H20FN3O — CID 111025701
1-(3-ethoxypropyl)-2-[(4-fluorophenyl)methyl]guanidine (PubChem CID 111025701) has the molecular formula C13H20FN3O and a molecular weight of 253.32 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-2-[(4-fluorophenyl)methyl]guanidine.
| Compound Name | 1-(3-ethoxypropyl)-2-[(4-fluorophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111025701 |
| Molecular Formula | C13H20FN3O |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 1-(3-ethoxypropyl)-2-[(4-fluorophenyl)methyl]guanidine |
| SMILES | CCOCCCN/C(N)=N/Cc1ccc(F)cc1 |
| InChI | InChI=1S/C13H20FN3O/c1-2-18-9-3-8-16-13(15)17-10-11-4-6-12(14)7-5-11/h4-7H,2-3,8-10H2,1H3,(H3,15,16,17) |
| InChIKey | RJJQZBFXBFURFV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|