C25H32N6O3 — CID 11102652
ethyl (2S)-3-(4-aminophenyl)-2-[[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]piperidine-1-carbonyl]amino]propanoate (PubChem CID 11102652) has the molecular formula C25H32N6O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is ethyl (2S)-3-(4-aminophenyl)-2-[[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]piperidine-1-carbonyl]amino]propanoate.
| Compound Name | ethyl (2S)-3-(4-aminophenyl)-2-[[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]piperidine-1-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 11102652 |
| Molecular Formula | C25H32N6O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | ethyl (2S)-3-(4-aminophenyl)-2-[[4-[(2-methylimidazo[4,5-c]pyridin-1-yl)methyl]piperidine-1-carbonyl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(N)cc1)NC(=O)N1CCC(Cn2c(C)nc3cnccc32)CC1 |
| InChI | InChI=1S/C25H32N6O3/c1-3-34-24(32)21(14-18-4-6-20(26)7-5-18)29-25(33)30-12-9-19(10-13-30)16-31-17(2)28-22-15-27-11-8-23(22)31/h4-8,11,15,19,21H,3,9-10,12-14,16,26H2,1-2H3,(H,29,33)/t21-/m0/s1 |
| InChIKey | ACMSOKWYNMZLCO-NRFANRHFSA-N |
| XLogP | 2.92 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|