C23H14F3N3O5 — CID 11102727
ethyl 5,10-dioxo-6-[2-[(2,2,2-trifluoroacetyl)amino]phenyl]pyrido[3,2-g]quinoline-3-carboxylate (PubChem CID 11102727) has the molecular formula C23H14F3N3O5 and a molecular weight of 469.38 g/mol. Its IUPAC name is ethyl 5,10-dioxo-6-[2-[(2,2,2-trifluoroacetyl)amino]phenyl]pyrido[3,2-g]quinoline-3-carboxylate.
| Compound Name | ethyl 5,10-dioxo-6-[2-[(2,2,2-trifluoroacetyl)amino]phenyl]pyrido[3,2-g]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 11102727 |
| Molecular Formula | C23H14F3N3O5 |
| Molecular Weight | 469.38 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | ethyl 5,10-dioxo-6-[2-[(2,2,2-trifluoroacetyl)amino]phenyl]pyrido[3,2-g]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(c1)C(=O)c1c(-c3ccccc3NC(=O)C(F)(F)F)ccnc1C2=O |
| InChI | InChI=1S/C23H14F3N3O5/c1-2-34-21(32)11-9-14-17(28-10-11)20(31)18-16(19(14)30)13(7-8-27-18)12-5-3-4-6-15(12)29-22(33)23(24,25)26/h3-10H,2H2,1H3,(H,29,33) |
| InChIKey | DXQRWLHHNFKEIY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|