C16H26FIN4 — CID 111029389
N'-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111029389) has the molecular formula C16H26FIN4 and a molecular weight of 420.31 g/mol. Its IUPAC name is N'-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111029389 |
| Molecular Formula | C16H26FIN4 |
| Molecular Weight | 420.31 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | N'-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CN(C)C(C/N=C(\N)N1CCCCC1)c1cccc(F)c1.I |
| InChI | InChI=1S/C16H25FN4.HI/c1-20(2)15(13-7-6-8-14(17)11-13)12-19-16(18)21-9-4-3-5-10-21;/h6-8,11,15H,3-5,9-10,12H2,1-2H3,(H2,18,19);1H |
| InChIKey | GQESZOVXRPKQJD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|