C33H58OSi — CID 11103093
[(3Z)-3-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexyl]oxy-tert-butyl-dimethylsilane (PubChem CID 11103093) has the molecular formula C33H58OSi and a molecular weight of 498.91 g/mol. Its IUPAC name is [(3Z)-3-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexyl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3Z)-3-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexyl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11103093 |
| Molecular Formula | C33H58OSi |
| Molecular Weight | 498.91 g/mol |
| Exact Mass | 498.43 |
| IUPAC Name | [(3Z)-3-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexyl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C1/C(=C\C=C2/CCC[C@]3(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@@H]23)CCCC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H58OSi/c1-24(2)14-11-15-25(3)29-21-22-30-28(17-13-23-33(29,30)8)20-19-27-16-12-18-31(26(27)4)34-35(9,10)32(5,6)7/h19-20,24-25,29-31H,4,11-18,21-23H2,1-3,5-10H3/b27-19-,28-20+/t25-,29-,30+,31?,33-/m1/s1 |
| InChIKey | FXKNPLFNSIEMKV-GRSCPBPPSA-N |
| XLogP | 10.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.91 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|