C21H21F3N2O7S — CID 11103120
methyl 3-[(4aS,8aS)-2-(benzenesulfonyl)-1,6-dioxo-3,4,4a,5-tetrahydroisoquinolin-8a-yl]-2-[(2,2,2-trifluoroacetyl)amino]propanoate (PubChem CID 11103120) has the molecular formula C21H21F3N2O7S and a molecular weight of 502.47 g/mol. Its IUPAC name is methyl 3-[(4aS,8aS)-2-(benzenesulfonyl)-1,6-dioxo-3,4,4a,5-tetrahydroisoquinolin-8a-yl]-2-[(2,2,2-trifluoroacetyl)amino]propanoate.
| Compound Name | methyl 3-[(4aS,8aS)-2-(benzenesulfonyl)-1,6-dioxo-3,4,4a,5-tetrahydroisoquinolin-8a-yl]-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
|---|---|
| PubChem CID | 11103120 |
| Molecular Formula | C21H21F3N2O7S |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | methyl 3-[(4aS,8aS)-2-(benzenesulfonyl)-1,6-dioxo-3,4,4a,5-tetrahydroisoquinolin-8a-yl]-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| SMILES | COC(=O)C(C[C@@]12C=CC(=O)C[C@@H]1CCN(S(=O)(=O)c1ccccc1)C2=O)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C21H21F3N2O7S/c1-33-17(28)16(25-18(29)21(22,23)24)12-20-9-7-14(27)11-13(20)8-10-26(19(20)30)34(31,32)15-5-3-2-4-6-15/h2-7,9,13,16H,8,10-12H2,1H3,(H,25,29)/t13-,16?,20-/m0/s1 |
| InChIKey | DGXWVOJOLVNVAC-SCGJFBFUSA-N |
| XLogP | 1.35 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |