C29H26O4S2 — CID 11103130
1-methyl-4-(1-methylsulfonyl-2,3,3-triphenylprop-2-enyl)sulfonylbenzene (PubChem CID 11103130) has the molecular formula C29H26O4S2 and a molecular weight of 502.66 g/mol. Its IUPAC name is 1-methyl-4-(1-methylsulfonyl-2,3,3-triphenylprop-2-enyl)sulfonylbenzene.
| Compound Name | 1-methyl-4-(1-methylsulfonyl-2,3,3-triphenylprop-2-enyl)sulfonylbenzene |
|---|---|
| PubChem CID | 11103130 |
| Molecular Formula | C29H26O4S2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | 1-methyl-4-(1-methylsulfonyl-2,3,3-triphenylprop-2-enyl)sulfonylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)C(C(=C(c2ccccc2)c2ccccc2)c2ccccc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C29H26O4S2/c1-22-18-20-26(21-19-22)35(32,33)29(34(2,30)31)28(25-16-10-5-11-17-25)27(23-12-6-3-7-13-23)24-14-8-4-9-15-24/h3-21,29H,1-2H3 |
| InChIKey | OOAWHZZPWQENDR-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|