C35H39NO2 — CID 11103163
(1R,2R)-1-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-1-phenyl-3-trityloxypropan-2-ol (PubChem CID 11103163) has the molecular formula C35H39NO2 and a molecular weight of 505.70 g/mol. Its IUPAC name is (1R,2R)-1-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-1-phenyl-3-trityloxypropan-2-ol.
| Compound Name | (1R,2R)-1-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-1-phenyl-3-trityloxypropan-2-ol |
|---|---|
| PubChem CID | 11103163 |
| Molecular Formula | C35H39NO2 |
| Molecular Weight | 505.70 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | (1R,2R)-1-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-1-phenyl-3-trityloxypropan-2-ol |
| SMILES | C[C@@H]1CCC[C@H](C)N1[C@H](c1ccccc1)[C@@H](O)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H39NO2/c1-27-16-15-17-28(2)36(27)34(29-18-7-3-8-19-29)33(37)26-38-35(30-20-9-4-10-21-30,31-22-11-5-12-23-31)32-24-13-6-14-25-32/h3-14,18-25,27-28,33-34,37H,15-17,26H2,1-2H3/t27-,28+,33-,34+/m0/s1 |
| InChIKey | YLXKTWZXPQEUGZ-BLXACNBASA-N |
| XLogP | 7.36 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.70 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|