C15H26N6 — CID 111031930
3-methyl-N'-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperidine-1-carboximidamide (PubChem CID 111031930) has the molecular formula C15H26N6 and a molecular weight of 290.41 g/mol. Its IUPAC name is 3-methyl-N'-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperidine-1-carboximidamide.
| Compound Name | 3-methyl-N'-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111031930 |
| Molecular Formula | C15H26N6 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 3-methyl-N'-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)piperidine-1-carboximidamide |
| SMILES | CC1CCCN(/C(N)=N/Cc2nnc3n2CCCCC3)C1 |
| InChI | InChI=1S/C15H26N6/c1-12-6-5-8-20(11-12)15(16)17-10-14-19-18-13-7-3-2-4-9-21(13)14/h12H,2-11H2,1H3,(H2,16,17) |
| InChIKey | MZCBDNKPDONGNN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 72.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|