C13H17F3N4O2 — CID 111032162
2-[[amino-[4-(trifluoromethoxy)anilino]methylidene]amino]-N-propylacetamide (PubChem CID 111032162) has the molecular formula C13H17F3N4O2 and a molecular weight of 318.30 g/mol. Its IUPAC name is 2-[[amino-[4-(trifluoromethoxy)anilino]methylidene]amino]-N-propylacetamide.
| Compound Name | 2-[[amino-[4-(trifluoromethoxy)anilino]methylidene]amino]-N-propylacetamide |
|---|---|
| PubChem CID | 111032162 |
| Molecular Formula | C13H17F3N4O2 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 2-[[amino-[4-(trifluoromethoxy)anilino]methylidene]amino]-N-propylacetamide |
| SMILES | CCCNC(=O)C/N=C(\N)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H17F3N4O2/c1-2-7-18-11(21)8-19-12(17)20-9-3-5-10(6-4-9)22-13(14,15)16/h3-6H,2,7-8H2,1H3,(H,18,21)(H3,17,19,20) |
| InChIKey | KNVBZXZJYOIRRE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|