C14H22FN3S — CID 111032772
2-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-1,1,3,3-tetramethylguanidine (PubChem CID 111032772) has the molecular formula C14H22FN3S and a molecular weight of 283.42 g/mol. Its IUPAC name is 2-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 111032772 |
| Molecular Formula | C14H22FN3S |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 2-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-1,1,3,3-tetramethylguanidine |
| SMILES | CN(C)C(=NCCSCc1ccccc1F)N(C)C |
| InChI | InChI=1S/C14H22FN3S/c1-17(2)14(18(3)4)16-9-10-19-11-12-7-5-6-8-13(12)15/h5-8H,9-11H2,1-4H3 |
| InChIKey | HVFHOJSKVGLBDG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|