C17H19ClFN3OS — CID 111032792
1-(3-chloro-4-methoxyphenyl)-2-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]guanidine (PubChem CID 111032792) has the molecular formula C17H19ClFN3OS and a molecular weight of 367.88 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]guanidine.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]guanidine |
|---|---|
| PubChem CID | 111032792 |
| Molecular Formula | C17H19ClFN3OS |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]guanidine |
| SMILES | COc1ccc(N/C(N)=N/CCSCc2ccccc2F)cc1Cl |
| InChI | InChI=1S/C17H19ClFN3OS/c1-23-16-7-6-13(10-14(16)18)22-17(20)21-8-9-24-11-12-4-2-3-5-15(12)19/h2-7,10H,8-9,11H2,1H3,(H3,20,21,22) |
| InChIKey | JTUNGOCLUORQQY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|