C17H27IN6O — CID 111033748
1-[2-(1H-benzimidazol-2-yl)ethyl]-2-methyl-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide (PubChem CID 111033748) has the molecular formula C17H27IN6O and a molecular weight of 458.35 g/mol. Its IUPAC name is 1-[2-(1H-benzimidazol-2-yl)ethyl]-2-methyl-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(1H-benzimidazol-2-yl)ethyl]-2-methyl-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111033748 |
| Molecular Formula | C17H27IN6O |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 1-[2-(1H-benzimidazol-2-yl)ethyl]-2-methyl-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1nc2ccccc2[nH]1)NCCN1CCOCC1.I |
| InChI | InChI=1S/C17H26N6O.HI/c1-18-17(20-8-9-23-10-12-24-13-11-23)19-7-6-16-21-14-4-2-3-5-15(14)22-16;/h2-5H,6-13H2,1H3,(H,21,22)(H2,18,19,20);1H |
| InChIKey | FUCOLXCRTCHVOT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|