C15H26N4 — CID 111034041
1-tert-butyl-2-[[4-[(dimethylamino)methyl]phenyl]methyl]guanidine (PubChem CID 111034041) has the molecular formula C15H26N4 and a molecular weight of 262.40 g/mol. Its IUPAC name is 1-tert-butyl-2-[[4-[(dimethylamino)methyl]phenyl]methyl]guanidine.
| Compound Name | 1-tert-butyl-2-[[4-[(dimethylamino)methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111034041 |
| Molecular Formula | C15H26N4 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | 1-tert-butyl-2-[[4-[(dimethylamino)methyl]phenyl]methyl]guanidine |
| SMILES | CN(C)Cc1ccc(C/N=C(\N)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C15H26N4/c1-15(2,3)18-14(16)17-10-12-6-8-13(9-7-12)11-19(4)5/h6-9H,10-11H2,1-5H3,(H3,16,17,18) |
| InChIKey | ZMBMOEZDNUYKHB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|