C28H36N2O4S2 — CID 11103410
N-[4-[5-(dithiolan-3-yl)pentanoylamino]phenyl]-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxamide (PubChem CID 11103410) has the molecular formula C28H36N2O4S2 and a molecular weight of 528.74 g/mol. Its IUPAC name is N-[4-[5-(dithiolan-3-yl)pentanoylamino]phenyl]-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxamide.
| Compound Name | N-[4-[5-(dithiolan-3-yl)pentanoylamino]phenyl]-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxamide |
|---|---|
| PubChem CID | 11103410 |
| Molecular Formula | C28H36N2O4S2 |
| Molecular Weight | 528.74 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | N-[4-[5-(dithiolan-3-yl)pentanoylamino]phenyl]-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxamide |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(C(=O)Nc1ccc(NC(=O)CCCCC3CCSS3)cc1)O2 |
| InChI | InChI=1S/C28H36N2O4S2/c1-17-18(2)26-23(19(3)25(17)32)13-15-28(4,34-26)27(33)30-21-11-9-20(10-12-21)29-24(31)8-6-5-7-22-14-16-35-36-22/h9-12,22,32H,5-8,13-16H2,1-4H3,(H,29,31)(H,30,33) |
| InChIKey | CPURDDMQPRRMEV-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.74 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|