About tert-butyl-[(E,4S)-4-(methoxymethoxy)-4-tributylstannylbut-2-enoxy]-dimethylsilane
tert-butyl-[(E,4S)-4-(methoxymethoxy)-4-tributylstannylbut-2-enoxy]-dimethylsilane (PubChem CID 11103468) has the molecular formula C24H52O3SiSn
and a molecular weight of 535.47 g/mol. Its IUPAC name is tert-butyl-[(E,4S)-4-(methoxymethoxy)-4-tributylstannylbut-2-enoxy]-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(E,4S)-4-(methoxymethoxy)-4-tributylstannylbut-2-enoxy]-dimethylsilane |
| PubChem CID | 11103468 |
| Molecular Formula | C24H52O3SiSn |
| Molecular Weight | 535.47 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | tert-butyl-[(E,4S)-4-(methoxymethoxy)-4-tributylstannylbut-2-enoxy]-dimethylsilane |
| SMILES | CCCC[Sn](CCCC)(CCCC)[C@@H](/C=C/CO[Si](C)(C)C(C)(C)C)OCOC |
| InChI | InChI=1S/C12H25O3Si.3C4H9.Sn/c1-12(2,3)16(5,6)15-10-8-7-9-14-11-13-4;3*1-3-4-2;/h7-9H,10-11H2,1-6H3;3*1,3-4H2,2H3;/b8-7+;;;; |
| InChIKey | KSRRVARKILCECQ-YZNHWISSSA-N |
| XLogP | 7.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 535.47 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(E,4S)-4-(methoxymethoxy)-4-tributylstannylbut-2-enoxy]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(E,4S)-4-(methoxymethoxy)-4-tributylstannylbut-2-enoxy]-dimethylsilane?
The IUPAC name of tert-butyl-[(E,4S)-4-(methoxymethoxy)-4-tributylstannylbut-2-enoxy]-dimethylsilane (CID 11103468) is tert-butyl-[(E,4S)-4-(methoxymethoxy)-4-tributylstannylbut-2-enoxy]-dimethylsilane.
What is the SMILES notation for tert-butyl-[(E,4S)-4-(methoxymethoxy)-4-tributylstannylbut-2-enoxy]-dimethylsilane?
The canonical SMILES for tert-butyl-[(E,4S)-4-(methoxymethoxy)-4-tributylstannylbut-2-enoxy]-dimethylsilane is CCCC[Sn](CCCC)(CCCC)[C@@H](/C=C/CO[Si](C)(C)C(C)(C)C)OCOC.
What is the InChIKey of tert-butyl-[(E,4S)-4-(methoxymethoxy)-4-tributylstannylbut-2-enoxy]-dimethylsilane?
The InChIKey is KSRRVARKILCECQ-YZNHWISSSA-N. The full InChI is InChI=1S/C12H25O3Si.3C4H9.Sn/c1-12(2,3)16(5,6)15-10-8-7-9-14-11-13-4;3*1-3-4-2;/h7-9H,10-11H2,1-6H3;3*1,3-4H2,2H3;/b8-7+;;;;.
What are the key properties of tert-butyl-[(E,4S)-4-(methoxymethoxy)-4-tributylstannylbut-2-enoxy]-dimethylsilane?
tert-butyl-[(E,4S)-4-(methoxymethoxy)-4-tributylstannylbut-2-enoxy]-dimethylsilane has a molecular weight of 535.47 g/mol, XLogP of 7.94, 17 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(E,4S)-4-(methoxymethoxy)-4-tributylstannylbut-2-enoxy]-dimethylsilane is sourced from PubChem (CID 11103468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).