C28H39IN2O2 — CID 11103709
[4-[2-(9-indol-1-ylnonoxy)-2-oxoethyl]phenyl]-trimethylazanium iodide (PubChem CID 11103709) has the molecular formula C28H39IN2O2 and a molecular weight of 562.54 g/mol. Its IUPAC name is [4-[2-(9-indol-1-ylnonoxy)-2-oxoethyl]phenyl]-trimethylazanium iodide.
| Compound Name | [4-[2-(9-indol-1-ylnonoxy)-2-oxoethyl]phenyl]-trimethylazanium iodide |
|---|---|
| PubChem CID | 11103709 |
| Molecular Formula | C28H39IN2O2 |
| Molecular Weight | 562.54 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | [4-[2-(9-indol-1-ylnonoxy)-2-oxoethyl]phenyl]-trimethylazanium iodide |
| SMILES | C[N+](C)(C)c1ccc(CC(=O)OCCCCCCCCCn2ccc3ccccc32)cc1.[I-] |
| InChI | InChI=1S/C28H39N2O2.HI/c1-30(2,3)26-17-15-24(16-18-26)23-28(31)32-22-12-8-6-4-5-7-11-20-29-21-19-25-13-9-10-14-27(25)29;/h9-10,13-19,21H,4-8,11-12,20,22-23H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | HXKWSCHFWVVYKZ-UHFFFAOYSA-M |
| XLogP | 3.36 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|