C22H27N3O2 — CID 111038472
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(1-phenylcyclopentyl)methyl]guanidine (PubChem CID 111038472) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(1-phenylcyclopentyl)methyl]guanidine.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(1-phenylcyclopentyl)methyl]guanidine |
|---|---|
| PubChem CID | 111038472 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(1-phenylcyclopentyl)methyl]guanidine |
| SMILES | N/C(=N\CC1(c2ccccc2)CCCC1)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C22H27N3O2/c23-21(25-18-9-10-19-20(15-18)27-14-6-13-26-19)24-16-22(11-4-5-12-22)17-7-2-1-3-8-17/h1-3,7-10,15H,4-6,11-14,16H2,(H3,23,24,25) |
| InChIKey | LYFBMSPXFNCCPV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|