About bis(2-methoxyphenyl) carbonate
bis(2-methoxyphenyl) carbonate (PubChem CID 11104) has the molecular formula C15H14O5
and a molecular weight of 274.27 g/mol. Its IUPAC name is bis(2-methoxyphenyl) carbonate.
Molecular Properties
| Compound Name | bis(2-methoxyphenyl) carbonate |
| PubChem CID | 11104 |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | bis(2-methoxyphenyl) carbonate |
| SMILES | COc1ccccc1OC(=O)Oc1ccccc1OC |
| InChI | InChI=1S/C15H14O5/c1-17-11-7-3-5-9-13(11)19-15(16)20-14-10-6-4-8-12(14)18-2/h3-10H,1-2H3 |
| InChIKey | ORUJFMPWKPVXLZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methoxyphenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methoxyphenyl) carbonate?
The IUPAC name of bis(2-methoxyphenyl) carbonate (CID 11104) is bis(2-methoxyphenyl) carbonate.
What is the SMILES notation for bis(2-methoxyphenyl) carbonate?
The canonical SMILES for bis(2-methoxyphenyl) carbonate is COc1ccccc1OC(=O)Oc1ccccc1OC.
What is the InChIKey of bis(2-methoxyphenyl) carbonate?
The InChIKey is ORUJFMPWKPVXLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O5/c1-17-11-7-3-5-9-13(11)19-15(16)20-14-10-6-4-8-12(14)18-2/h3-10H,1-2H3.
What are the key properties of bis(2-methoxyphenyl) carbonate?
bis(2-methoxyphenyl) carbonate has a molecular weight of 274.27 g/mol, XLogP of 3.28, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methoxyphenyl) carbonate is sourced from PubChem (CID 11104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).