C33H62O7Si2 — CID 11104125
ethyl (E,4S,5S,6R)-6-[(2R)-6-hydroxy-6-methyl-3-oxo-5-[tri(propan-2-yl)silyloxymethyl]pyran-2-yl]-2,4-dimethyl-5-triethylsilyloxyhept-2-enoate (PubChem CID 11104125) has the molecular formula C33H62O7Si2 and a molecular weight of 627.02 g/mol. Its IUPAC name is ethyl (E,4S,5S,6R)-6-[(2R)-6-hydroxy-6-methyl-3-oxo-5-[tri(propan-2-yl)silyloxymethyl]pyran-2-yl]-2,4-dimethyl-5-triethylsilyloxyhept-2-enoate.
| Compound Name | ethyl (E,4S,5S,6R)-6-[(2R)-6-hydroxy-6-methyl-3-oxo-5-[tri(propan-2-yl)silyloxymethyl]pyran-2-yl]-2,4-dimethyl-5-triethylsilyloxyhept-2-enoate |
|---|---|
| PubChem CID | 11104125 |
| Molecular Formula | C33H62O7Si2 |
| Molecular Weight | 627.02 g/mol |
| Exact Mass | 626.40 |
| IUPAC Name | ethyl (E,4S,5S,6R)-6-[(2R)-6-hydroxy-6-methyl-3-oxo-5-[tri(propan-2-yl)silyloxymethyl]pyran-2-yl]-2,4-dimethyl-5-triethylsilyloxyhept-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@H](C)[C@H](O[Si](CC)(CC)CC)[C@H](C)[C@H]1OC(C)(O)C(CO[Si](C(C)C)(C(C)C)C(C)C)=CC1=O |
| InChI | InChI=1S/C33H62O7Si2/c1-15-37-32(35)26(12)19-25(11)30(40-41(16-2,17-3)18-4)27(13)31-29(34)20-28(33(14,36)39-31)21-38-42(22(5)6,23(7)8)24(9)10/h19-20,22-25,27,30-31,36H,15-18,21H2,1-14H3/b26-19+/t25-,27-,30-,31+,33?/m0/s1 |
| InChIKey | XTFCENNVGFFZKP-ZGFUIAFHSA-N |
| XLogP | 7.95 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.02 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|