C15H18ClIN4 — CID 111041944
2-[(6-chloro-3-pyridinyl)methyl]-1-(3-ethylphenyl)guanidine;hydroiodide (PubChem CID 111041944) has the molecular formula C15H18ClIN4 and a molecular weight of 416.69 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)methyl]-1-(3-ethylphenyl)guanidine;hydroiodide.
| Compound Name | 2-[(6-chloro-3-pyridinyl)methyl]-1-(3-ethylphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111041944 |
| Molecular Formula | C15H18ClIN4 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)methyl]-1-(3-ethylphenyl)guanidine;hydroiodide |
| SMILES | CCc1cccc(N/C(N)=N/Cc2ccc(Cl)nc2)c1.I |
| InChI | InChI=1S/C15H17ClN4.HI/c1-2-11-4-3-5-13(8-11)20-15(17)19-10-12-6-7-14(16)18-9-12;/h3-9H,2,10H2,1H3,(H3,17,19,20);1H |
| InChIKey | QMVSDNWPVYMECH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|