C20H31N5O4 — CID 111043070
tert-butyl 4-[N'-[2-[(3-methoxybenzoyl)amino]ethyl]carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111043070) has the molecular formula C20H31N5O4 and a molecular weight of 405.50 g/mol. Its IUPAC name is tert-butyl 4-[N'-[2-[(3-methoxybenzoyl)amino]ethyl]carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[N'-[2-[(3-methoxybenzoyl)amino]ethyl]carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111043070 |
| Molecular Formula | C20H31N5O4 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | tert-butyl 4-[N'-[2-[(3-methoxybenzoyl)amino]ethyl]carbamimidoyl]piperazine-1-carboxylate |
| SMILES | COc1cccc(C(=O)NCC/N=C(\N)N2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C20H31N5O4/c1-20(2,3)29-19(27)25-12-10-24(11-13-25)18(21)23-9-8-22-17(26)15-6-5-7-16(14-15)28-4/h5-7,14H,8-13H2,1-4H3,(H2,21,23)(H,22,26) |
| InChIKey | QSBWZYMYTBLQIU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|