C16H28IN3O2 — CID 111044421
1-[2-(2,5-dimethoxyphenyl)ethyl]-2-(3-methylbutyl)guanidine;hydroiodide (PubChem CID 111044421) has the molecular formula C16H28IN3O2 and a molecular weight of 421.32 g/mol. Its IUPAC name is 1-[2-(2,5-dimethoxyphenyl)ethyl]-2-(3-methylbutyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2,5-dimethoxyphenyl)ethyl]-2-(3-methylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111044421 |
| Molecular Formula | C16H28IN3O2 |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 1-[2-(2,5-dimethoxyphenyl)ethyl]-2-(3-methylbutyl)guanidine;hydroiodide |
| SMILES | COc1ccc(OC)c(CCN/C(N)=N/CCC(C)C)c1.I |
| InChI | InChI=1S/C16H27N3O2.HI/c1-12(2)7-9-18-16(17)19-10-8-13-11-14(20-3)5-6-15(13)21-4;/h5-6,11-12H,7-10H2,1-4H3,(H3,17,18,19);1H |
| InChIKey | CXZQWNOSYNRCFI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|