C21H29N5 — CID 111048742
1-(3,4-dimethylphenyl)-2-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]guanidine (PubChem CID 111048742) has the molecular formula C21H29N5 and a molecular weight of 351.50 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-(3,4-dimethylphenyl)-2-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111048742 |
| Molecular Formula | C21H29N5 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]guanidine |
| SMILES | Cc1ccc(N/C(N)=N/Cc2ccc(N3CCC(C)CC3)nc2)cc1C |
| InChI | InChI=1S/C21H29N5/c1-15-8-10-26(11-9-15)20-7-5-18(13-23-20)14-24-21(22)25-19-6-4-16(2)17(3)12-19/h4-7,12-13,15H,8-11,14H2,1-3H3,(H3,22,24,25) |
| InChIKey | GZSHBMIZWQFZNP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|