C24H29IN4O3 — CID 111050501
1-(2,5-diethoxyphenyl)-2-[(2-phenylmethoxy-4-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 111050501) has the molecular formula C24H29IN4O3 and a molecular weight of 548.43 g/mol. Its IUPAC name is 1-(2,5-diethoxyphenyl)-2-[(2-phenylmethoxy-4-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(2,5-diethoxyphenyl)-2-[(2-phenylmethoxy-4-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111050501 |
| Molecular Formula | C24H29IN4O3 |
| Molecular Weight | 548.43 g/mol |
| Exact Mass | 548.13 |
| IUPAC Name | 1-(2,5-diethoxyphenyl)-2-[(2-phenylmethoxy-4-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | CCOc1ccc(OCC)c(N/C(N)=N/Cc2ccnc(OCc3ccccc3)c2)c1.I |
| InChI | InChI=1S/C24H28N4O3.HI/c1-3-29-20-10-11-22(30-4-2)21(15-20)28-24(25)27-16-19-12-13-26-23(14-19)31-17-18-8-6-5-7-9-18;/h5-15H,3-4,16-17H2,1-2H3,(H3,25,27,28);1H |
| InChIKey | SXOLHJYMUDNXSV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|