C17H27IN4O — CID 111052600
1,1-diethyl-2-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 111052600) has the molecular formula C17H27IN4O and a molecular weight of 430.33 g/mol. Its IUPAC name is 1,1-diethyl-2-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1,1-diethyl-2-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111052600 |
| Molecular Formula | C17H27IN4O |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 1,1-diethyl-2-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN(CC)/C(N)=N/Cc1ccccc1CN1CCCC1=O.I |
| InChI | InChI=1S/C17H26N4O.HI/c1-3-20(4-2)17(18)19-12-14-8-5-6-9-15(14)13-21-11-7-10-16(21)22;/h5-6,8-9H,3-4,7,10-13H2,1-2H3,(H2,18,19);1H |
| InChIKey | QVHRTKOLYISBPG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|