C25H34N4O — CID 111052647
1-butyl-2-[(4-methylphenyl)methyl]-3-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine (PubChem CID 111052647) has the molecular formula C25H34N4O and a molecular weight of 406.57 g/mol. Its IUPAC name is 1-butyl-2-[(4-methylphenyl)methyl]-3-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine.
| Compound Name | 1-butyl-2-[(4-methylphenyl)methyl]-3-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111052647 |
| Molecular Formula | C25H34N4O |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 1-butyl-2-[(4-methylphenyl)methyl]-3-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine |
| SMILES | CCCCN/C(=N\Cc1ccc(C)cc1)NCc1ccccc1CN1CCCC1=O |
| InChI | InChI=1S/C25H34N4O/c1-3-4-15-26-25(27-17-21-13-11-20(2)12-14-21)28-18-22-8-5-6-9-23(22)19-29-16-7-10-24(29)30/h5-6,8-9,11-14H,3-4,7,10,15-19H2,1-2H3,(H2,26,27,28) |
| InChIKey | SHPYHRKWPTUZLO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|