About 2-methylpyran-4-one
2-methylpyran-4-one (PubChem CID 11105333) has the molecular formula C6H6O2
and a molecular weight of 110.11 g/mol. Its IUPAC name is 2-methylpyran-4-one.
Molecular Properties
| Compound Name | 2-methylpyran-4-one |
| PubChem CID | 11105333 |
| Molecular Formula | C6H6O2 |
| Molecular Weight | 110.11 g/mol |
| Exact Mass | 110.04 |
| IUPAC Name | 2-methylpyran-4-one |
| SMILES | Cc1cc(=O)cco1 |
| InChI | InChI=1S/C6H6O2/c1-5-4-6(7)2-3-8-5/h2-4H,1H3 |
| InChIKey | NQOJWZRPLXJDPX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.11 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylpyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpyran-4-one?
The IUPAC name of 2-methylpyran-4-one (CID 11105333) is 2-methylpyran-4-one.
What is the SMILES notation for 2-methylpyran-4-one?
The canonical SMILES for 2-methylpyran-4-one is Cc1cc(=O)cco1.
What is the InChIKey of 2-methylpyran-4-one?
The InChIKey is NQOJWZRPLXJDPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2/c1-5-4-6(7)2-3-8-5/h2-4H,1H3.
What are the key properties of 2-methylpyran-4-one?
2-methylpyran-4-one has a molecular weight of 110.11 g/mol, XLogP of 0.95, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpyran-4-one is sourced from PubChem (CID 11105333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).