C24H33N5O — CID 111053537
1-[[4-(2,3-dihydroindol-1-ylmethyl)phenyl]methyl]-2-methyl-3-(2-morpholin-4-ylethyl)guanidine (PubChem CID 111053537) has the molecular formula C24H33N5O and a molecular weight of 407.56 g/mol. Its IUPAC name is 1-[[4-(2,3-dihydroindol-1-ylmethyl)phenyl]methyl]-2-methyl-3-(2-morpholin-4-ylethyl)guanidine.
| Compound Name | 1-[[4-(2,3-dihydroindol-1-ylmethyl)phenyl]methyl]-2-methyl-3-(2-morpholin-4-ylethyl)guanidine |
|---|---|
| PubChem CID | 111053537 |
| Molecular Formula | C24H33N5O |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | 1-[[4-(2,3-dihydroindol-1-ylmethyl)phenyl]methyl]-2-methyl-3-(2-morpholin-4-ylethyl)guanidine |
| SMILES | C/N=C(\NCCN1CCOCC1)NCc1ccc(CN2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C24H33N5O/c1-25-24(26-11-13-28-14-16-30-17-15-28)27-18-20-6-8-21(9-7-20)19-29-12-10-22-4-2-3-5-23(22)29/h2-9H,10-19H2,1H3,(H2,25,26,27) |
| InChIKey | BAZLFRGPSCYEQZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|