About (4S)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde
(4S)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde (PubChem CID 11105390) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is (4S)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde.
Molecular Properties
| Compound Name | (4S)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
| PubChem CID | 11105390 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | (4S)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
| SMILES | CC1(C)OC[C@@H](C=O)O1 |
| InChI | InChI=1S/C6H10O3/c1-6(2)8-4-5(3-7)9-6/h3,5H,4H2,1-2H3/t5-/m1/s1 |
| InChIKey | YSGPYVWACGYQDJ-RXMQYKEDSA-N |
| XLogP | 0.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (4S)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde?
The IUPAC name of (4S)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde (CID 11105390) is (4S)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde.
What is the SMILES notation for (4S)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde?
The canonical SMILES for (4S)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde is CC1(C)OC[C@@H](C=O)O1.
What is the InChIKey of (4S)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde?
The InChIKey is YSGPYVWACGYQDJ-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H10O3/c1-6(2)8-4-5(3-7)9-6/h3,5H,4H2,1-2H3/t5-/m1/s1.
What are the key properties of (4S)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde?
(4S)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde has a molecular weight of 130.14 g/mol, XLogP of 0.34, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde is sourced from PubChem (CID 11105390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).