C21H26ClFN4O — CID 111054413
2-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]-1-(3-methylphenyl)guanidine (PubChem CID 111054413) has the molecular formula C21H26ClFN4O and a molecular weight of 404.92 g/mol. Its IUPAC name is 2-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]-1-(3-methylphenyl)guanidine.
| Compound Name | 2-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]-1-(3-methylphenyl)guanidine |
|---|---|
| PubChem CID | 111054413 |
| Molecular Formula | C21H26ClFN4O |
| Molecular Weight | 404.92 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 2-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]-1-(3-methylphenyl)guanidine |
| SMILES | Cc1cccc(N/C(N)=N/CC(c2c(F)cccc2Cl)N2CCOC(C)C2)c1 |
| InChI | InChI=1S/C21H26ClFN4O/c1-14-5-3-6-16(11-14)26-21(24)25-12-19(27-9-10-28-15(2)13-27)20-17(22)7-4-8-18(20)23/h3-8,11,15,19H,9-10,12-13H2,1-2H3,(H3,24,25,26) |
| InChIKey | PBQMRUAZUOIBSH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.92 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|