About prop-2-ynyl 2-nitroacetate
prop-2-ynyl 2-nitroacetate (PubChem CID 11105476) has the molecular formula C5H5NO4
and a molecular weight of 143.10 g/mol. Its IUPAC name is prop-2-ynyl 2-nitroacetate.
Molecular Properties
| Compound Name | prop-2-ynyl 2-nitroacetate |
| PubChem CID | 11105476 |
| Molecular Formula | C5H5NO4 |
| Molecular Weight | 143.10 g/mol |
| Exact Mass | 143.02 |
| IUPAC Name | prop-2-ynyl 2-nitroacetate |
| SMILES | C#CCOC(=O)C[N+](=O)[O-] |
| InChI | InChI=1S/C5H5NO4/c1-2-3-10-5(7)4-6(8)9/h1H,3-4H2 |
| InChIKey | JTOZZRVYYPPGFR-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.10 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ynyl 2-nitroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ynyl 2-nitroacetate?
The IUPAC name of prop-2-ynyl 2-nitroacetate (CID 11105476) is prop-2-ynyl 2-nitroacetate.
What is the SMILES notation for prop-2-ynyl 2-nitroacetate?
The canonical SMILES for prop-2-ynyl 2-nitroacetate is C#CCOC(=O)C[N+](=O)[O-].
What is the InChIKey of prop-2-ynyl 2-nitroacetate?
The InChIKey is JTOZZRVYYPPGFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO4/c1-2-3-10-5(7)4-6(8)9/h1H,3-4H2.
What are the key properties of prop-2-ynyl 2-nitroacetate?
prop-2-ynyl 2-nitroacetate has a molecular weight of 143.10 g/mol, XLogP of -0.56, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynyl 2-nitroacetate is sourced from PubChem (CID 11105476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).