About (1S,4R)-3-ethenylidene-2,2-dimethylbicyclo[2.2.1]heptane
(1S,4R)-3-ethenylidene-2,2-dimethylbicyclo[2.2.1]heptane (PubChem CID 11105521) has the molecular formula C11H16
and a molecular weight of 148.25 g/mol. Its IUPAC name is (1S,4R)-3-ethenylidene-2,2-dimethylbicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | (1S,4R)-3-ethenylidene-2,2-dimethylbicyclo[2.2.1]heptane |
| PubChem CID | 11105521 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | (1S,4R)-3-ethenylidene-2,2-dimethylbicyclo[2.2.1]heptane |
| SMILES | C=C=C1[C@@H]2CC[C@@H](C2)C1(C)C |
| InChI | InChI=1S/C11H16/c1-4-10-8-5-6-9(7-8)11(10,2)3/h8-9H,1,5-7H2,2-3H3/t8-,9+/m1/s1 |
| InChIKey | XGGBXPVDLOVYSK-BDAKNGLRSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (1S,4R)-3-ethenylidene-2,2-dimethylbicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,4R)-3-ethenylidene-2,2-dimethylbicyclo[2.2.1]heptane?
The IUPAC name of (1S,4R)-3-ethenylidene-2,2-dimethylbicyclo[2.2.1]heptane (CID 11105521) is (1S,4R)-3-ethenylidene-2,2-dimethylbicyclo[2.2.1]heptane.
What is the SMILES notation for (1S,4R)-3-ethenylidene-2,2-dimethylbicyclo[2.2.1]heptane?
The canonical SMILES for (1S,4R)-3-ethenylidene-2,2-dimethylbicyclo[2.2.1]heptane is C=C=C1[C@@H]2CC[C@@H](C2)C1(C)C.
What is the InChIKey of (1S,4R)-3-ethenylidene-2,2-dimethylbicyclo[2.2.1]heptane?
The InChIKey is XGGBXPVDLOVYSK-BDAKNGLRSA-N. The full InChI is InChI=1S/C11H16/c1-4-10-8-5-6-9(7-8)11(10,2)3/h8-9H,1,5-7H2,2-3H3/t8-,9+/m1/s1.
What are the key properties of (1S,4R)-3-ethenylidene-2,2-dimethylbicyclo[2.2.1]heptane?
(1S,4R)-3-ethenylidene-2,2-dimethylbicyclo[2.2.1]heptane has a molecular weight of 148.25 g/mol, XLogP of 3.15, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,4R)-3-ethenylidene-2,2-dimethylbicyclo[2.2.1]heptane is sourced from PubChem (CID 11105521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).