C20H27IN4 — CID 111055512
2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-1-(3-ethylphenyl)guanidine;hydroiodide (PubChem CID 111055512) has the molecular formula C20H27IN4 and a molecular weight of 450.37 g/mol. Its IUPAC name is 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-1-(3-ethylphenyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-1-(3-ethylphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111055512 |
| Molecular Formula | C20H27IN4 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-1-(3-ethylphenyl)guanidine;hydroiodide |
| SMILES | CCc1cccc(N/C(N)=N/CCN2CCc3ccccc3C2)c1.I |
| InChI | InChI=1S/C20H26N4.HI/c1-2-16-6-5-9-19(14-16)23-20(21)22-11-13-24-12-10-17-7-3-4-8-18(17)15-24;/h3-9,14H,2,10-13,15H2,1H3,(H3,21,22,23);1H |
| InChIKey | HLIJIENBVQHDCE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|