About (2R,5S)-2-(dimethoxymethyl)-5-methyl-2,5-dihydrofuran
(2R,5S)-2-(dimethoxymethyl)-5-methyl-2,5-dihydrofuran (PubChem CID 11105629) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is (2R,5S)-2-(dimethoxymethyl)-5-methyl-2,5-dihydrofuran.
Molecular Properties
| Compound Name | (2R,5S)-2-(dimethoxymethyl)-5-methyl-2,5-dihydrofuran |
| PubChem CID | 11105629 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (2R,5S)-2-(dimethoxymethyl)-5-methyl-2,5-dihydrofuran |
| SMILES | COC(OC)[C@H]1C=C[C@H](C)O1 |
| InChI | InChI=1S/C8H14O3/c1-6-4-5-7(11-6)8(9-2)10-3/h4-8H,1-3H3/t6-,7+/m0/s1 |
| InChIKey | GVAXTPYAAHQWSC-NKWVEPMBSA-N |
| XLogP | 0.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R,5S)-2-(dimethoxymethyl)-5-methyl-2,5-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5S)-2-(dimethoxymethyl)-5-methyl-2,5-dihydrofuran?
The IUPAC name of (2R,5S)-2-(dimethoxymethyl)-5-methyl-2,5-dihydrofuran (CID 11105629) is (2R,5S)-2-(dimethoxymethyl)-5-methyl-2,5-dihydrofuran.
What is the SMILES notation for (2R,5S)-2-(dimethoxymethyl)-5-methyl-2,5-dihydrofuran?
The canonical SMILES for (2R,5S)-2-(dimethoxymethyl)-5-methyl-2,5-dihydrofuran is COC(OC)[C@H]1C=C[C@H](C)O1.
What is the InChIKey of (2R,5S)-2-(dimethoxymethyl)-5-methyl-2,5-dihydrofuran?
The InChIKey is GVAXTPYAAHQWSC-NKWVEPMBSA-N. The full InChI is InChI=1S/C8H14O3/c1-6-4-5-7(11-6)8(9-2)10-3/h4-8H,1-3H3/t6-,7+/m0/s1.
What are the key properties of (2R,5S)-2-(dimethoxymethyl)-5-methyl-2,5-dihydrofuran?
(2R,5S)-2-(dimethoxymethyl)-5-methyl-2,5-dihydrofuran has a molecular weight of 158.20 g/mol, XLogP of 0.95, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5S)-2-(dimethoxymethyl)-5-methyl-2,5-dihydrofuran is sourced from PubChem (CID 11105629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).