About (4S)-4-(hydroxymethyl)-3,5,5-trimethylcyclohex-2-en-1-one
(4S)-4-(hydroxymethyl)-3,5,5-trimethylcyclohex-2-en-1-one (PubChem CID 11105753) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is (4S)-4-(hydroxymethyl)-3,5,5-trimethylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | (4S)-4-(hydroxymethyl)-3,5,5-trimethylcyclohex-2-en-1-one |
| PubChem CID | 11105753 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (4S)-4-(hydroxymethyl)-3,5,5-trimethylcyclohex-2-en-1-one |
| SMILES | CC1=CC(=O)CC(C)(C)[C@@H]1CO |
| InChI | InChI=1S/C10H16O2/c1-7-4-8(12)5-10(2,3)9(7)6-11/h4,9,11H,5-6H2,1-3H3/t9-/m1/s1 |
| InChIKey | KURIDZCRFQNRTO-SECBINFHSA-N |
| XLogP | 1.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-4-(hydroxymethyl)-3,5,5-trimethylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(hydroxymethyl)-3,5,5-trimethylcyclohex-2-en-1-one?
The IUPAC name of (4S)-4-(hydroxymethyl)-3,5,5-trimethylcyclohex-2-en-1-one (CID 11105753) is (4S)-4-(hydroxymethyl)-3,5,5-trimethylcyclohex-2-en-1-one.
What is the SMILES notation for (4S)-4-(hydroxymethyl)-3,5,5-trimethylcyclohex-2-en-1-one?
The canonical SMILES for (4S)-4-(hydroxymethyl)-3,5,5-trimethylcyclohex-2-en-1-one is CC1=CC(=O)CC(C)(C)[C@@H]1CO.
What is the InChIKey of (4S)-4-(hydroxymethyl)-3,5,5-trimethylcyclohex-2-en-1-one?
The InChIKey is KURIDZCRFQNRTO-SECBINFHSA-N. The full InChI is InChI=1S/C10H16O2/c1-7-4-8(12)5-10(2,3)9(7)6-11/h4,9,11H,5-6H2,1-3H3/t9-/m1/s1.
What are the key properties of (4S)-4-(hydroxymethyl)-3,5,5-trimethylcyclohex-2-en-1-one?
(4S)-4-(hydroxymethyl)-3,5,5-trimethylcyclohex-2-en-1-one has a molecular weight of 168.24 g/mol, XLogP of 1.54, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(hydroxymethyl)-3,5,5-trimethylcyclohex-2-en-1-one is sourced from PubChem (CID 11105753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).