C13H25F3N4O2 — CID 111057698
1-(3-morpholin-4-ylpropyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine (PubChem CID 111057698) has the molecular formula C13H25F3N4O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is 1-(3-morpholin-4-ylpropyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine.
| Compound Name | 1-(3-morpholin-4-ylpropyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111057698 |
| Molecular Formula | C13H25F3N4O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 1-(3-morpholin-4-ylpropyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
| SMILES | N/C(=N\CCCOCC(F)(F)F)NCCCN1CCOCC1 |
| InChI | InChI=1S/C13H25F3N4O2/c14-13(15,16)11-22-8-2-4-19-12(17)18-3-1-5-20-6-9-21-10-7-20/h1-11H2,(H3,17,18,19) |
| InChIKey | OUWKJYMNNAZMGV-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|