C10H19NO — CID 11105779
(1R)-1-[(3aS,6S,6aR)-6a-methyl-2,3,3a,4,5,6-hexahydro-1H-cyclopenta[b]pyrrol-6-yl]ethanol (PubChem CID 11105779) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (1R)-1-[(3aS,6S,6aR)-6a-methyl-2,3,3a,4,5,6-hexahydro-1H-cyclopenta[b]pyrrol-6-yl]ethanol.
| Compound Name | (1R)-1-[(3aS,6S,6aR)-6a-methyl-2,3,3a,4,5,6-hexahydro-1H-cyclopenta[b]pyrrol-6-yl]ethanol |
|---|---|
| PubChem CID | 11105779 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (1R)-1-[(3aS,6S,6aR)-6a-methyl-2,3,3a,4,5,6-hexahydro-1H-cyclopenta[b]pyrrol-6-yl]ethanol |
| SMILES | C[C@@H](O)[C@H]1CC[C@H]2CCN[C@]21C |
| InChI | InChI=1S/C10H19NO/c1-7(12)9-4-3-8-5-6-11-10(8,9)2/h7-9,11-12H,3-6H2,1-2H3/t7-,8+,9-,10-/m1/s1 |
| InChIKey | ORKKUYLRUSEPQL-UTINFBMNSA-N |
| XLogP | 1.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |