About 8-ethynyl-1,4-dioxaspiro[4.5]decan-8-ol
8-ethynyl-1,4-dioxaspiro[4.5]decan-8-ol (PubChem CID 11105985) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is 8-ethynyl-1,4-dioxaspiro[4.5]decan-8-ol.
Molecular Properties
| Compound Name | 8-ethynyl-1,4-dioxaspiro[4.5]decan-8-ol |
| PubChem CID | 11105985 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 8-ethynyl-1,4-dioxaspiro[4.5]decan-8-ol |
| SMILES | C#CC1(O)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C10H14O3/c1-2-9(11)3-5-10(6-4-9)12-7-8-13-10/h1,11H,3-8H2 |
| InChIKey | GBKHOSZWZAISIU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-ethynyl-1,4-dioxaspiro[4.5]decan-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethynyl-1,4-dioxaspiro[4.5]decan-8-ol?
The IUPAC name of 8-ethynyl-1,4-dioxaspiro[4.5]decan-8-ol (CID 11105985) is 8-ethynyl-1,4-dioxaspiro[4.5]decan-8-ol.
What is the SMILES notation for 8-ethynyl-1,4-dioxaspiro[4.5]decan-8-ol?
The canonical SMILES for 8-ethynyl-1,4-dioxaspiro[4.5]decan-8-ol is C#CC1(O)CCC2(CC1)OCCO2.
What is the InChIKey of 8-ethynyl-1,4-dioxaspiro[4.5]decan-8-ol?
The InChIKey is GBKHOSZWZAISIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3/c1-2-9(11)3-5-10(6-4-9)12-7-8-13-10/h1,11H,3-8H2.
What are the key properties of 8-ethynyl-1,4-dioxaspiro[4.5]decan-8-ol?
8-ethynyl-1,4-dioxaspiro[4.5]decan-8-ol has a molecular weight of 182.22 g/mol, XLogP of 0.67, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethynyl-1,4-dioxaspiro[4.5]decan-8-ol is sourced from PubChem (CID 11105985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).