C15H32N4 — CID 111060073
1,1-diethyl-2-[4-(2-methylpiperidin-1-yl)butyl]guanidine (PubChem CID 111060073) has the molecular formula C15H32N4 and a molecular weight of 268.45 g/mol. Its IUPAC name is 1,1-diethyl-2-[4-(2-methylpiperidin-1-yl)butyl]guanidine.
| Compound Name | 1,1-diethyl-2-[4-(2-methylpiperidin-1-yl)butyl]guanidine |
|---|---|
| PubChem CID | 111060073 |
| Molecular Formula | C15H32N4 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.26 |
| IUPAC Name | 1,1-diethyl-2-[4-(2-methylpiperidin-1-yl)butyl]guanidine |
| SMILES | CCN(CC)/C(N)=N/CCCCN1CCCCC1C |
| InChI | InChI=1S/C15H32N4/c1-4-18(5-2)15(16)17-11-7-9-13-19-12-8-6-10-14(19)3/h14H,4-13H2,1-3H3,(H2,16,17) |
| InChIKey | DXZSYFGXAYLXTL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|