About (1S)-1-[(1S,2R)-2-(2-hydroxypropan-2-yl)-1-methylcyclobutyl]ethane-1,2-diol
(1S)-1-[(1S,2R)-2-(2-hydroxypropan-2-yl)-1-methylcyclobutyl]ethane-1,2-diol (PubChem CID 11106109) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is (1S)-1-[(1S,2R)-2-(2-hydroxypropan-2-yl)-1-methylcyclobutyl]ethane-1,2-diol.
Molecular Properties
| Compound Name | (1S)-1-[(1S,2R)-2-(2-hydroxypropan-2-yl)-1-methylcyclobutyl]ethane-1,2-diol |
| PubChem CID | 11106109 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | (1S)-1-[(1S,2R)-2-(2-hydroxypropan-2-yl)-1-methylcyclobutyl]ethane-1,2-diol |
| SMILES | CC(C)(O)[C@@H]1CC[C@]1(C)[C@H](O)CO |
| InChI | InChI=1S/C10H20O3/c1-9(2,13)7-4-5-10(7,3)8(12)6-11/h7-8,11-13H,4-6H2,1-3H3/t7-,8+,10-/m0/s1 |
| InChIKey | WUUTVVFWUFRWGW-XKSSXDPKSA-N |
| XLogP | 0.53 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S)-1-[(1S,2R)-2-(2-hydroxypropan-2-yl)-1-methylcyclobutyl]ethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[(1S,2R)-2-(2-hydroxypropan-2-yl)-1-methylcyclobutyl]ethane-1,2-diol?
The IUPAC name of (1S)-1-[(1S,2R)-2-(2-hydroxypropan-2-yl)-1-methylcyclobutyl]ethane-1,2-diol (CID 11106109) is (1S)-1-[(1S,2R)-2-(2-hydroxypropan-2-yl)-1-methylcyclobutyl]ethane-1,2-diol.
What is the SMILES notation for (1S)-1-[(1S,2R)-2-(2-hydroxypropan-2-yl)-1-methylcyclobutyl]ethane-1,2-diol?
The canonical SMILES for (1S)-1-[(1S,2R)-2-(2-hydroxypropan-2-yl)-1-methylcyclobutyl]ethane-1,2-diol is CC(C)(O)[C@@H]1CC[C@]1(C)[C@H](O)CO.
What is the InChIKey of (1S)-1-[(1S,2R)-2-(2-hydroxypropan-2-yl)-1-methylcyclobutyl]ethane-1,2-diol?
The InChIKey is WUUTVVFWUFRWGW-XKSSXDPKSA-N. The full InChI is InChI=1S/C10H20O3/c1-9(2,13)7-4-5-10(7,3)8(12)6-11/h7-8,11-13H,4-6H2,1-3H3/t7-,8+,10-/m0/s1.
What are the key properties of (1S)-1-[(1S,2R)-2-(2-hydroxypropan-2-yl)-1-methylcyclobutyl]ethane-1,2-diol?
(1S)-1-[(1S,2R)-2-(2-hydroxypropan-2-yl)-1-methylcyclobutyl]ethane-1,2-diol has a molecular weight of 188.27 g/mol, XLogP of 0.53, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[(1S,2R)-2-(2-hydroxypropan-2-yl)-1-methylcyclobutyl]ethane-1,2-diol is sourced from PubChem (CID 11106109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).