C19H21N5 — CID 111063322
1-(3,4-dimethylphenyl)-2-[(4-pyrazol-1-ylphenyl)methyl]guanidine (PubChem CID 111063322) has the molecular formula C19H21N5 and a molecular weight of 319.41 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-[(4-pyrazol-1-ylphenyl)methyl]guanidine.
| Compound Name | 1-(3,4-dimethylphenyl)-2-[(4-pyrazol-1-ylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111063322 |
| Molecular Formula | C19H21N5 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-[(4-pyrazol-1-ylphenyl)methyl]guanidine |
| SMILES | Cc1ccc(N/C(N)=N/Cc2ccc(-n3cccn3)cc2)cc1C |
| InChI | InChI=1S/C19H21N5/c1-14-4-7-17(12-15(14)2)23-19(20)21-13-16-5-8-18(9-6-16)24-11-3-10-22-24/h3-12H,13H2,1-2H3,(H3,20,21,23) |
| InChIKey | OLFLIEOUMAXXOF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|