About magnesium;2,2,6,6-tetramethylpiperidin-1-ide;chloride
magnesium;2,2,6,6-tetramethylpiperidin-1-ide;chloride (PubChem CID 11106352) has the molecular formula C9H18ClMgN
and a molecular weight of 200.01 g/mol. Its IUPAC name is magnesium;2,2,6,6-tetramethylpiperidin-1-ide;chloride.
Molecular Properties
| Compound Name | magnesium;2,2,6,6-tetramethylpiperidin-1-ide;chloride |
| PubChem CID | 11106352 |
| Molecular Formula | C9H18ClMgN |
| Molecular Weight | 200.01 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | magnesium;2,2,6,6-tetramethylpiperidin-1-ide;chloride |
| SMILES | CC1(C)CCCC(C)(C)[N-]1.[Cl-].[Mg+2] |
| InChI | InChI=1S/C9H18N.ClH.Mg/c1-8(2)6-5-7-9(3,4)10-8;;/h5-7H2,1-4H3;1H;/q-1;;+2/p-1 |
| InChIKey | ULKSWZAXQDJMJT-UHFFFAOYSA-M |
| XLogP | -0.28 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.01 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze magnesium;2,2,6,6-tetramethylpiperidin-1-ide;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;2,2,6,6-tetramethylpiperidin-1-ide;chloride?
The IUPAC name of magnesium;2,2,6,6-tetramethylpiperidin-1-ide;chloride (CID 11106352) is magnesium;2,2,6,6-tetramethylpiperidin-1-ide;chloride.
What is the SMILES notation for magnesium;2,2,6,6-tetramethylpiperidin-1-ide;chloride?
The canonical SMILES for magnesium;2,2,6,6-tetramethylpiperidin-1-ide;chloride is CC1(C)CCCC(C)(C)[N-]1.[Cl-].[Mg+2].
What is the InChIKey of magnesium;2,2,6,6-tetramethylpiperidin-1-ide;chloride?
The InChIKey is ULKSWZAXQDJMJT-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H18N.ClH.Mg/c1-8(2)6-5-7-9(3,4)10-8;;/h5-7H2,1-4H3;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;2,2,6,6-tetramethylpiperidin-1-ide;chloride?
magnesium;2,2,6,6-tetramethylpiperidin-1-ide;chloride has a molecular weight of 200.01 g/mol, XLogP of -0.28, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;2,2,6,6-tetramethylpiperidin-1-ide;chloride is sourced from PubChem (CID 11106352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).