C18H27N5 — CID 111064081
1-hexyl-2-[[4-(imidazol-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111064081) has the molecular formula C18H27N5 and a molecular weight of 313.45 g/mol. Its IUPAC name is 1-hexyl-2-[[4-(imidazol-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-hexyl-2-[[4-(imidazol-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111064081 |
| Molecular Formula | C18H27N5 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | 1-hexyl-2-[[4-(imidazol-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | CCCCCCN/C(N)=N/Cc1ccc(Cn2ccnc2)cc1 |
| InChI | InChI=1S/C18H27N5/c1-2-3-4-5-10-21-18(19)22-13-16-6-8-17(9-7-16)14-23-12-11-20-15-23/h6-9,11-12,15H,2-5,10,13-14H2,1H3,(H3,19,21,22) |
| InChIKey | BONLBZDUQMPVHM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|