About 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-cyclohexylguanidine;hydroiodide
2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-cyclohexylguanidine;hydroiodide (PubChem CID 111064293) has the molecular formula C19H23IN4OS
and a molecular weight of 482.39 g/mol. Its IUPAC name is 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-cyclohexylguanidine;hydroiodide.
Molecular Properties
| Compound Name | 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-cyclohexylguanidine;hydroiodide |
| PubChem CID | 111064293 |
| Molecular Formula | C19H23IN4OS |
| Molecular Weight | 482.39 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-cyclohexylguanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccc(-c2nc3ccccc3s2)o1)NC1CCCCC1 |
| InChI | InChI=1S/C19H22N4OS.HI/c20-19(22-13-6-2-1-3-7-13)21-12-14-10-11-16(24-14)18-23-15-8-4-5-9-17(15)25-18;/h4-5,8-11,13H,1-3,6-7,12H2,(H3,20,21,22);1H |
| InChIKey | IJBITJYZOFCKSI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.39 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-cyclohexylguanidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-cyclohexylguanidine;hydroiodide?
The IUPAC name of 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-cyclohexylguanidine;hydroiodide (CID 111064293) is 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-cyclohexylguanidine;hydroiodide.
What is the SMILES notation for 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-cyclohexylguanidine;hydroiodide?
The canonical SMILES for 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-cyclohexylguanidine;hydroiodide is I.N/C(=N\Cc1ccc(-c2nc3ccccc3s2)o1)NC1CCCCC1.
What is the InChIKey of 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-cyclohexylguanidine;hydroiodide?
The InChIKey is IJBITJYZOFCKSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4OS.HI/c20-19(22-13-6-2-1-3-7-13)21-12-14-10-11-16(24-14)18-23-15-8-4-5-9-17(15)25-18;/h4-5,8-11,13H,1-3,6-7,12H2,(H3,20,21,22);1H.
What are the key properties of 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-cyclohexylguanidine;hydroiodide?
2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-cyclohexylguanidine;hydroiodide has a molecular weight of 482.39 g/mol, XLogP of 4.91, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-cyclohexylguanidine;hydroiodide is sourced from PubChem (CID 111064293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).