About N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]morpholine-4-carboximidamide
N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]morpholine-4-carboximidamide (PubChem CID 111065408) has the molecular formula C12H21F3N4O
and a molecular weight of 294.32 g/mol. Its IUPAC name is N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]morpholine-4-carboximidamide.
Molecular Properties
| Compound Name | N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]morpholine-4-carboximidamide |
| PubChem CID | 111065408 |
| Molecular Formula | C12H21F3N4O |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]morpholine-4-carboximidamide |
| SMILES | N/C(=N\CC1CCN(CC(F)(F)F)C1)N1CCOCC1 |
| InChI | InChI=1S/C12H21F3N4O/c13-12(14,15)9-18-2-1-10(8-18)7-17-11(16)19-3-5-20-6-4-19/h10H,1-9H2,(H2,16,17) |
| InChIKey | JLGUJVXVBUKXDK-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]morpholine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]morpholine-4-carboximidamide?
The IUPAC name of N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]morpholine-4-carboximidamide (CID 111065408) is N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]morpholine-4-carboximidamide.
What is the SMILES notation for N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]morpholine-4-carboximidamide?
The canonical SMILES for N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]morpholine-4-carboximidamide is N/C(=N\CC1CCN(CC(F)(F)F)C1)N1CCOCC1.
What is the InChIKey of N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]morpholine-4-carboximidamide?
The InChIKey is JLGUJVXVBUKXDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F3N4O/c13-12(14,15)9-18-2-1-10(8-18)7-17-11(16)19-3-5-20-6-4-19/h10H,1-9H2,(H2,16,17).
What are the key properties of N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]morpholine-4-carboximidamide?
N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]morpholine-4-carboximidamide has a molecular weight of 294.32 g/mol, XLogP of 0.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]morpholine-4-carboximidamide is sourced from PubChem (CID 111065408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).