C15H28F3N5O — CID 111065488
2-methyl-1-(2-morpholin-4-ylethyl)-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine (PubChem CID 111065488) has the molecular formula C15H28F3N5O and a molecular weight of 351.42 g/mol. Its IUPAC name is 2-methyl-1-(2-morpholin-4-ylethyl)-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine.
| Compound Name | 2-methyl-1-(2-morpholin-4-ylethyl)-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111065488 |
| Molecular Formula | C15H28F3N5O |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 2-methyl-1-(2-morpholin-4-ylethyl)-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine |
| SMILES | C/N=C(/NCCN1CCOCC1)NCC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C15H28F3N5O/c1-19-14(20-3-5-22-6-8-24-9-7-22)21-10-13-2-4-23(11-13)12-15(16,17)18/h13H,2-12H2,1H3,(H2,19,20,21) |
| InChIKey | CTVMIGXEPDOBQP-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|