C13H20O2 — CID 11106592
(4S,5R)-4,5-dimethyl-2-[(1R,2R,3S,4S)-3-methyl-2-bicyclo[2.2.1]hept-5-enyl]-1,3-dioxolane (PubChem CID 11106592) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (4S,5R)-4,5-dimethyl-2-[(1R,2R,3S,4S)-3-methyl-2-bicyclo[2.2.1]hept-5-enyl]-1,3-dioxolane.
| Compound Name | (4S,5R)-4,5-dimethyl-2-[(1R,2R,3S,4S)-3-methyl-2-bicyclo[2.2.1]hept-5-enyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 11106592 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (4S,5R)-4,5-dimethyl-2-[(1R,2R,3S,4S)-3-methyl-2-bicyclo[2.2.1]hept-5-enyl]-1,3-dioxolane |
| SMILES | C[C@@H]1[C@@H](C2O[C@@H](C)[C@@H](C)O2)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C13H20O2/c1-7-10-4-5-11(6-10)12(7)13-14-8(2)9(3)15-13/h4-5,7-13H,6H2,1-3H3/t7-,8-,9+,10+,11-,12+,13?/m0/s1 |
| InChIKey | VQCDWYPHSWAVOV-IEHZPRKSSA-N |
| XLogP | 2.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|