C11H21F3N4O — CID 111066453
N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]morpholine-4-carboximidamide (PubChem CID 111066453) has the molecular formula C11H21F3N4O and a molecular weight of 282.31 g/mol. Its IUPAC name is N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]morpholine-4-carboximidamide.
| Compound Name | N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111066453 |
| Molecular Formula | C11H21F3N4O |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]morpholine-4-carboximidamide |
| SMILES | CN(CCC/N=C(\N)N1CCOCC1)CC(F)(F)F |
| InChI | InChI=1S/C11H21F3N4O/c1-17(9-11(12,13)14)4-2-3-16-10(15)18-5-7-19-8-6-18/h2-9H2,1H3,(H2,15,16) |
| InChIKey | FALQWZIXOIGHJC-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|