About 1,1-diethyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide
1,1-diethyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide (PubChem CID 111067167) has the molecular formula C9H22IN3O2S
and a molecular weight of 363.27 g/mol. Its IUPAC name is 1,1-diethyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide.
Molecular Properties
| Compound Name | 1,1-diethyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide |
| PubChem CID | 111067167 |
| Molecular Formula | C9H22IN3O2S |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 1,1-diethyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide |
| SMILES | CCN(CC)/C(N)=N/CCCS(C)(=O)=O.I |
| InChI | InChI=1S/C9H21N3O2S.HI/c1-4-12(5-2)9(10)11-7-6-8-15(3,13)14;/h4-8H2,1-3H3,(H2,10,11);1H |
| InChIKey | YPNFYDQLGZHEIK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diethyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diethyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide?
The IUPAC name of 1,1-diethyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide (CID 111067167) is 1,1-diethyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide.
What is the SMILES notation for 1,1-diethyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide?
The canonical SMILES for 1,1-diethyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide is CCN(CC)/C(N)=N/CCCS(C)(=O)=O.I.
What is the InChIKey of 1,1-diethyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide?
The InChIKey is YPNFYDQLGZHEIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3O2S.HI/c1-4-12(5-2)9(10)11-7-6-8-15(3,13)14;/h4-8H2,1-3H3,(H2,10,11);1H.
What are the key properties of 1,1-diethyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide?
1,1-diethyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide has a molecular weight of 363.27 g/mol, XLogP of 0.70, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diethyl-2-(3-methylsulfonylpropyl)guanidine;hydroiodide is sourced from PubChem (CID 111067167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).